Anemarsaponin B
Cat. No. :YN330585
CAS No. :139051-27-7
Pack size
price
inventory
10mg
$ 457.00
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Anemarsaponin B |
| CAS NO.: | 139051-27-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 903.06 |
| Molecular Formula: | C₄₅H₇₄O₁₈ |
| SMILES: | OC1C(CO)OC(OC2CCC(C(CCC3(C)C4CC5C3C(C)=C(CCC(COC6OC(CO)C(O)C(O)C6O)C)O5)C4CC7)(C)C7C2)C(OC8OC(CO)C(O)C(O)C8O)C1O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Anemarsaponin B is a steroidal saponin isolated from the rhizomes ofA. asphodeloides(Liliaceae). Anemarsaponin B decreases the protein and mRNA levels ofiNOS and COX-2. Anemarsaponin B reduces the expressions and productions of pro-inflammatory cytokines, including TNF-a and IL-6. Anemarsaponin B inhibits the nuclear translocation of the p65 subunit ofNF-κBby blocking the phosphorylation of IκBα. Anemarsaponin B also inhibits the phosphorylation of MAP kinase kinases 3/6 (MKK3/6) and mixed lineage kinase 3 (MLK3). Anti-inflammatory effect. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
