Agrimol B
Cat. No. :YN310347
CAS No. :55576-66-4
Pack size
price
inventory
10mg
$ 686.00
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Agrimol B |
| CAS NO.: | 55576-66-4 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 682.75 |
| Molecular Formula: | C₃₇H₄₆O₁₂ |
| SMILES: | CC[C@H](C)C(C1=C(O)C(CC2=C(O)C(C(CCC)=O)=C(OC)C(C)=C2O)=C(O)C(CC3=C(O)C(C(CCC)=O)=C(OC)C(C)=C3O)=C1O)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Agrimol B is a polyphenol derived fromAgrimonia pilosa Ledeb, suppresses adipogenesis via inducingSIRT1translocation and expression, and reducingPPARγexpression. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
