Theaflavin 3,3'-digallate
Cat. No. :YN350239
CAS No. :30462-35-2
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Theaflavin 3,3'-digallate |
| CAS NO.: | 30462-35-2 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 868.70 |
| Molecular Formula: | C₄₃H₃₂O₂₀ |
| SMILES: | O=C(C1=CC(O)=C(O)C(O)=C1)O[C@H](CC2=C3O)[C@H](OC2=CC(O)=C3)C4=C(C=C([C@@H](OC5=CC(O)=CC(O)=C5C6)[C@@H]6OC(C7=CC(O)=C(O)C(O)=C7)=O)C=C(O)C8=O)C8=C(O)C(O)=C4 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Theaflavin 3,3'-digallate (TF3), the typical pigment in black tea, is a good antitumor agent. Theaflavin 3,3'-digallate is generally regarded as the effective component for the inhibitory effects against carcinogenesis without adverse side effects by affecting multiple signal transduction pathways, such as upregulating p53 and p21, inhibiting phosphorylation of the cell survival proteinAkt and MAPKpathway, downregulation ofNF-κB, shifting the ratio between pro-/antiapoptotic proteins. Theaflavin 3,3'-digallate causes a rapid and sustained decrease in phospho-ERK1/2 and -MEK1/2protein expression. Theaflavin 3,3'-digallate inhibits HCT116 cell growth with an IC50 of 17.26μM. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.