42-(2-Tetrazolyl)rapamycin
Cat. No. :YN480802
CAS No. :221877-56-1
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | 42-(2-Tetrazolyl)rapamycin |
| CAS NO.: | 221877-56-1 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 966.21 |
| Molecular Formula: | C₅₂H₇₉N₅O₁₂ |
| SMILES: | [H][C@]1(C(O[C@@]([C@@H](C[C@H]2C[C@@H](OC)[C@@H](N3N=CN=N3)CC2)C)([H])CC([C@@H](/C=C([C@@H](O)[C@H]4OC)C)C)=O)=O)N(C(C([C@@]5(O)[C@H](C)CC[C@](C[C@@H](/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C4=O)OC)([H])O5)=O)=O)CCCC1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | 42-(2-Tetrazolyl)rapamycin is a prodrug compound of a rapamycin analog extracted from patent US 20080171763 A1, Example 1. Rapamycin is a specific mTOR inhibitor. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
